C22H18ClF3N2O2 — CID 20708915
(4-chloro-3-fluorophenyl) 2,6-difluoro-4-(5-pentylpyrimidin-2-yl)benzoate (PubChem CID 20708915) has the molecular formula C22H18ClF3N2O2 and a molecular weight of 434.85 g/mol. Its IUPAC name is (4-chloro-3-fluorophenyl) 2,6-difluoro-4-(5-pentylpyrimidin-2-yl)benzoate.
| Compound Name | (4-chloro-3-fluorophenyl) 2,6-difluoro-4-(5-pentylpyrimidin-2-yl)benzoate |
|---|---|
| PubChem CID | 20708915 |
| Molecular Formula | C22H18ClF3N2O2 |
| Molecular Weight | 434.85 g/mol |
| Exact Mass | 434.10 |
| IUPAC Name | (4-chloro-3-fluorophenyl) 2,6-difluoro-4-(5-pentylpyrimidin-2-yl)benzoate |
| SMILES | CCCCCc1cnc(-c2cc(F)c(C(=O)Oc3ccc(Cl)c(F)c3)c(F)c2)nc1 |
| InChI | InChI=1S/C22H18ClF3N2O2/c1-2-3-4-5-13-11-27-21(28-12-13)14-8-18(25)20(19(26)9-14)22(29)30-15-6-7-16(23)17(24)10-15/h6-12H,2-5H2,1H3 |
| InChIKey | LEODAFMPWWDKNH-UHFFFAOYSA-N |
| XLogP | 6.17 |
| TPSA | 52.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.85 |
| LogP ≤ 5 | 6.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|