C48H32F6N2O2 — CID 20710057
3-N,3-N-bis(4-methylphenyl)-9-N,9-N-bis[4-(trifluoromethoxy)phenyl]perylene-3,9-diamine (PubChem CID 20710057) has the molecular formula C48H32F6N2O2 and a molecular weight of 782.78 g/mol. Its IUPAC name is 3-N,3-N-bis(4-methylphenyl)-9-N,9-N-bis[4-(trifluoromethoxy)phenyl]perylene-3,9-diamine.
| Compound Name | 3-N,3-N-bis(4-methylphenyl)-9-N,9-N-bis[4-(trifluoromethoxy)phenyl]perylene-3,9-diamine |
|---|---|
| PubChem CID | 20710057 |
| Molecular Formula | C48H32F6N2O2 |
| Molecular Weight | 782.78 g/mol |
| Exact Mass | 782.24 |
| IUPAC Name | 3-N,3-N-bis(4-methylphenyl)-9-N,9-N-bis[4-(trifluoromethoxy)phenyl]perylene-3,9-diamine |
| SMILES | Cc1ccc(N(c2ccc(C)cc2)c2ccc3c4cccc5c(N(c6ccc(OC(F)(F)F)cc6)c6ccc(OC(F)(F)F)cc6)ccc(c6cccc2c63)c54)cc1 |
| InChI | InChI=1S/C48H32F6N2O2/c1-29-9-13-31(14-10-29)55(32-15-11-30(2)12-16-32)43-27-25-39-38-6-4-8-42-44(28-26-40(46(38)42)37-5-3-7-41(43)45(37)39)56(33-17-21-35(22-18-33)57-47(49,50)51)34-19-23-36(24-20-34)58-48(52,53)54/h3-28H,1-2H3 |
| InChIKey | QFSPQEYQCWDZMG-UHFFFAOYSA-N |
| XLogP | 15.09 |
| TPSA | 24.94 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 58 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 782.78 |
| LogP ≤ 5 | 15.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|