About (2-methyloxiran-2-yl)methyl naphthalen-2-yl sulfite
(2-methyloxiran-2-yl)methyl naphthalen-2-yl sulfite (PubChem CID 20710235) has the molecular formula C14H14O4S
and a molecular weight of 278.33 g/mol. Its IUPAC name is (2-methyloxiran-2-yl)methyl naphthalen-2-yl sulfite.
Molecular Properties
| Compound Name | (2-methyloxiran-2-yl)methyl naphthalen-2-yl sulfite |
| PubChem CID | 20710235 |
| Molecular Formula | C14H14O4S |
| Molecular Weight | 278.33 g/mol |
| Exact Mass | 278.06 |
| IUPAC Name | (2-methyloxiran-2-yl)methyl naphthalen-2-yl sulfite |
| SMILES | CC1(COS(=O)Oc2ccc3ccccc3c2)CO1 |
| InChI | InChI=1S/C14H14O4S/c1-14(9-16-14)10-17-19(15)18-13-7-6-11-4-2-3-5-12(11)8-13/h2-8H,9-10H2,1H3 |
| InChIKey | SGYFMJMLQWQJPN-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 48.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 278.33 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|
Analyze (2-methyloxiran-2-yl)methyl naphthalen-2-yl sulfite with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2-methyloxiran-2-yl)methyl naphthalen-2-yl sulfite?
The IUPAC name of (2-methyloxiran-2-yl)methyl naphthalen-2-yl sulfite (CID 20710235) is (2-methyloxiran-2-yl)methyl naphthalen-2-yl sulfite.
What is the SMILES notation for (2-methyloxiran-2-yl)methyl naphthalen-2-yl sulfite?
The canonical SMILES for (2-methyloxiran-2-yl)methyl naphthalen-2-yl sulfite is CC1(COS(=O)Oc2ccc3ccccc3c2)CO1.
What is the InChIKey of (2-methyloxiran-2-yl)methyl naphthalen-2-yl sulfite?
The InChIKey is SGYFMJMLQWQJPN-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H14O4S/c1-14(9-16-14)10-17-19(15)18-13-7-6-11-4-2-3-5-12(11)8-13/h2-8H,9-10H2,1H3.
What are the key properties of (2-methyloxiran-2-yl)methyl naphthalen-2-yl sulfite?
(2-methyloxiran-2-yl)methyl naphthalen-2-yl sulfite has a molecular weight of 278.33 g/mol, XLogP of 2.60, 5 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (2-methyloxiran-2-yl)methyl naphthalen-2-yl sulfite is sourced from PubChem (CID 20710235), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).