C18H12O6S2 — CID 20695862
naphthalen-2-yl (1,1,3-trioxo-1-benzothiophen-2-yl) sulfite (PubChem CID 20695862) has the molecular formula C18H12O6S2 and a molecular weight of 388.42 g/mol. Its IUPAC name is naphthalen-2-yl (1,1,3-trioxo-1-benzothiophen-2-yl) sulfite.
| Compound Name | naphthalen-2-yl (1,1,3-trioxo-1-benzothiophen-2-yl) sulfite |
|---|---|
| PubChem CID | 20695862 |
| Molecular Formula | C18H12O6S2 |
| Molecular Weight | 388.42 g/mol |
| Exact Mass | 388.01 |
| IUPAC Name | naphthalen-2-yl (1,1,3-trioxo-1-benzothiophen-2-yl) sulfite |
| SMILES | O=C1c2ccccc2S(=O)(=O)C1OS(=O)Oc1ccc2ccccc2c1 |
| InChI | InChI=1S/C18H12O6S2/c19-17-15-7-3-4-8-16(15)26(21,22)18(17)24-25(20)23-14-10-9-12-5-1-2-6-13(12)11-14/h1-11,18H |
| InChIKey | YZCLNDNSYMZLKB-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 86.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.42 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |