About dimethyl 6-fluoro-4,4-dimethyl-2-(methylamino)bicyclo[3.1.0]hexane-2,6-dicarboxylate
dimethyl 6-fluoro-4,4-dimethyl-2-(methylamino)bicyclo[3.1.0]hexane-2,6-dicarboxylate (PubChem CID 20715384) has the molecular formula C13H20FNO4
and a molecular weight of 273.30 g/mol. Its IUPAC name is dimethyl 6-fluoro-4,4-dimethyl-2-(methylamino)bicyclo[3.1.0]hexane-2,6-dicarboxylate.
Molecular Properties
| Compound Name | dimethyl 6-fluoro-4,4-dimethyl-2-(methylamino)bicyclo[3.1.0]hexane-2,6-dicarboxylate |
| PubChem CID | 20715384 |
| Molecular Formula | C13H20FNO4 |
| Molecular Weight | 273.30 g/mol |
| Exact Mass | 273.14 |
| IUPAC Name | dimethyl 6-fluoro-4,4-dimethyl-2-(methylamino)bicyclo[3.1.0]hexane-2,6-dicarboxylate |
| SMILES | CNC1(C(=O)OC)CC(C)(C)C2C1C2(F)C(=O)OC |
| InChI | InChI=1S/C13H20FNO4/c1-11(2)6-12(15-3,9(16)18-4)8-7(11)13(8,14)10(17)19-5/h7-8,15H,6H2,1-5H3 |
| InChIKey | QWMCZWBPJDVPFE-UHFFFAOYSA-N |
| XLogP | 0.67 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 273.30 |
| LogP ≤ 5 | 0.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze dimethyl 6-fluoro-4,4-dimethyl-2-(methylamino)bicyclo[3.1.0]hexane-2,6-dicarboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of dimethyl 6-fluoro-4,4-dimethyl-2-(methylamino)bicyclo[3.1.0]hexane-2,6-dicarboxylate?
The IUPAC name of dimethyl 6-fluoro-4,4-dimethyl-2-(methylamino)bicyclo[3.1.0]hexane-2,6-dicarboxylate (CID 20715384) is dimethyl 6-fluoro-4,4-dimethyl-2-(methylamino)bicyclo[3.1.0]hexane-2,6-dicarboxylate.
What is the SMILES notation for dimethyl 6-fluoro-4,4-dimethyl-2-(methylamino)bicyclo[3.1.0]hexane-2,6-dicarboxylate?
The canonical SMILES for dimethyl 6-fluoro-4,4-dimethyl-2-(methylamino)bicyclo[3.1.0]hexane-2,6-dicarboxylate is CNC1(C(=O)OC)CC(C)(C)C2C1C2(F)C(=O)OC.
What is the InChIKey of dimethyl 6-fluoro-4,4-dimethyl-2-(methylamino)bicyclo[3.1.0]hexane-2,6-dicarboxylate?
The InChIKey is QWMCZWBPJDVPFE-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H20FNO4/c1-11(2)6-12(15-3,9(16)18-4)8-7(11)13(8,14)10(17)19-5/h7-8,15H,6H2,1-5H3.
What are the key properties of dimethyl 6-fluoro-4,4-dimethyl-2-(methylamino)bicyclo[3.1.0]hexane-2,6-dicarboxylate?
dimethyl 6-fluoro-4,4-dimethyl-2-(methylamino)bicyclo[3.1.0]hexane-2,6-dicarboxylate has a molecular weight of 273.30 g/mol, XLogP of 0.67, 3 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for dimethyl 6-fluoro-4,4-dimethyl-2-(methylamino)bicyclo[3.1.0]hexane-2,6-dicarboxylate is sourced from PubChem (CID 20715384), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).