C19H27NO2 — CID 20716505
6,7-dimethyl-7a-(3-methylbutan-2-yl)-3-phenyl-1,3,6,7-tetrahydropyrrolo[1,2-c][1,3]oxazol-5-one (PubChem CID 20716505) has the molecular formula C19H27NO2 and a molecular weight of 301.43 g/mol. Its IUPAC name is 6,7-dimethyl-7a-(3-methylbutan-2-yl)-3-phenyl-1,3,6,7-tetrahydropyrrolo[1,2-c][1,3]oxazol-5-one.
| Compound Name | 6,7-dimethyl-7a-(3-methylbutan-2-yl)-3-phenyl-1,3,6,7-tetrahydropyrrolo[1,2-c][1,3]oxazol-5-one |
|---|---|
| PubChem CID | 20716505 |
| Molecular Formula | C19H27NO2 |
| Molecular Weight | 301.43 g/mol |
| Exact Mass | 301.20 |
| IUPAC Name | 6,7-dimethyl-7a-(3-methylbutan-2-yl)-3-phenyl-1,3,6,7-tetrahydropyrrolo[1,2-c][1,3]oxazol-5-one |
| SMILES | CC(C)C(C)C12COC(c3ccccc3)N1C(=O)C(C)C2C |
| InChI | InChI=1S/C19H27NO2/c1-12(2)14(4)19-11-22-18(16-9-7-6-8-10-16)20(19)17(21)13(3)15(19)5/h6-10,12-15,18H,11H2,1-5H3 |
| InChIKey | LZFGAGMRQWUVHM-UHFFFAOYSA-N |
| XLogP | 3.86 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.43 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |