C18H23NO2 — CID 54242371
(2R)-2-methyl-5-phenyl-4-oxa-6-azatricyclo[6.5.0.02,6]tridecan-7-one (PubChem CID 54242371) has the molecular formula C18H23NO2 and a molecular weight of 285.39 g/mol. Its IUPAC name is (2R)-2-methyl-5-phenyl-4-oxa-6-azatricyclo[6.5.0.02,6]tridecan-7-one.
| Compound Name | (2R)-2-methyl-5-phenyl-4-oxa-6-azatricyclo[6.5.0.02,6]tridecan-7-one |
|---|---|
| PubChem CID | 54242371 |
| Molecular Formula | C18H23NO2 |
| Molecular Weight | 285.39 g/mol |
| Exact Mass | 285.17 |
| IUPAC Name | (2R)-2-methyl-5-phenyl-4-oxa-6-azatricyclo[6.5.0.02,6]tridecan-7-one |
| SMILES | C[C@@]12COC(c3ccccc3)N1C(=O)C1CCCCCC12 |
| InChI | InChI=1S/C18H23NO2/c1-18-12-21-17(13-8-4-2-5-9-13)19(18)16(20)14-10-6-3-7-11-15(14)18/h2,4-5,8-9,14-15,17H,3,6-7,10-12H2,1H3/t14?,15?,17?,18-/m0/s1 |
| InChIKey | QQXJESIWGCRQRD-CSQARDAQSA-N |
| XLogP | 3.51 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.39 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |