C15H16NO3Rf- — CID 59869963
(7aR)-6,7-dimethyl-7a-(oxomethyl)-3-phenyl-1,3,6,7-tetrahydropyrrolo[1,2-c][1,3]oxazol-5-one;rutherfordium (PubChem CID 59869963) has the molecular formula C15H16NO3Rf- and a molecular weight of 525.30 g/mol. Its IUPAC name is (7aR)-6,7-dimethyl-7a-(oxomethyl)-3-phenyl-1,3,6,7-tetrahydropyrrolo[1,2-c][1,3]oxazol-5-one;rutherfordium.
| Compound Name | (7aR)-6,7-dimethyl-7a-(oxomethyl)-3-phenyl-1,3,6,7-tetrahydropyrrolo[1,2-c][1,3]oxazol-5-one;rutherfordium |
|---|---|
| PubChem CID | 59869963 |
| Molecular Formula | C15H16NO3Rf- |
| Molecular Weight | 525.30 g/mol |
| Exact Mass | 525.24 |
| IUPAC Name | (7aR)-6,7-dimethyl-7a-(oxomethyl)-3-phenyl-1,3,6,7-tetrahydropyrrolo[1,2-c][1,3]oxazol-5-one;rutherfordium |
| SMILES | CC1C(=O)N2C(c3ccccc3)OC[C@@]2([C-]=O)C1C.[Rf] |
| InChI | InChI=1S/C15H16NO3.Rf/c1-10-11(2)15(8-17)9-19-14(16(15)13(10)18)12-6-4-3-5-7-12;/h3-7,10-11,14H,9H2,1-2H3;/q-1;/t10?,11?,14?,15-;/m0./s1 |
| InChIKey | JKDCDISULITMRM-VONFCMJESA-N |
| XLogP | 1.68 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 525.30 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|