C23H17F5N2O3 — CID 20717173
[3,5-difluoro-4-(trifluoromethoxy)phenyl] 5-[(E)-2-(4-propylphenyl)ethenyl]pyrimidine-2-carboxylate (PubChem CID 20717173) has the molecular formula C23H17F5N2O3 and a molecular weight of 464.39 g/mol. Its IUPAC name is [3,5-difluoro-4-(trifluoromethoxy)phenyl] 5-[(E)-2-(4-propylphenyl)ethenyl]pyrimidine-2-carboxylate.
| Compound Name | [3,5-difluoro-4-(trifluoromethoxy)phenyl] 5-[(E)-2-(4-propylphenyl)ethenyl]pyrimidine-2-carboxylate |
|---|---|
| PubChem CID | 20717173 |
| Molecular Formula | C23H17F5N2O3 |
| Molecular Weight | 464.39 g/mol |
| Exact Mass | 464.12 |
| IUPAC Name | [3,5-difluoro-4-(trifluoromethoxy)phenyl] 5-[(E)-2-(4-propylphenyl)ethenyl]pyrimidine-2-carboxylate |
| SMILES | CCCc1ccc(/C=C/c2cnc(C(=O)Oc3cc(F)c(OC(F)(F)F)c(F)c3)nc2)cc1 |
| InChI | InChI=1S/C23H17F5N2O3/c1-2-3-14-4-6-15(7-5-14)8-9-16-12-29-21(30-13-16)22(31)32-17-10-18(24)20(19(25)11-17)33-23(26,27)28/h4-13H,2-3H2,1H3/b9-8+ |
| InChIKey | YPHUKSBDGOKASN-CMDGGOBGSA-N |
| XLogP | 6.00 |
| TPSA | 61.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.39 |
| LogP ≤ 5 | 6.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|