C17H27N3O3 — CID 20719038
[2-[3-[3-(dimethylamino)propylamino]-3-oxopropyl]-3-methylphenyl] N-methylcarbamate (PubChem CID 20719038) has the molecular formula C17H27N3O3 and a molecular weight of 321.42 g/mol. Its IUPAC name is [2-[3-[3-(dimethylamino)propylamino]-3-oxopropyl]-3-methylphenyl] N-methylcarbamate.
| Compound Name | [2-[3-[3-(dimethylamino)propylamino]-3-oxopropyl]-3-methylphenyl] N-methylcarbamate |
|---|---|
| PubChem CID | 20719038 |
| Molecular Formula | C17H27N3O3 |
| Molecular Weight | 321.42 g/mol |
| Exact Mass | 321.21 |
| IUPAC Name | [2-[3-[3-(dimethylamino)propylamino]-3-oxopropyl]-3-methylphenyl] N-methylcarbamate |
| SMILES | CNC(=O)Oc1cccc(C)c1CCC(=O)NCCCN(C)C |
| InChI | InChI=1S/C17H27N3O3/c1-13-7-5-8-15(23-17(22)18-2)14(13)9-10-16(21)19-11-6-12-20(3)4/h5,7-8H,6,9-12H2,1-4H3,(H,18,22)(H,19,21) |
| InChIKey | BIJJOVMOLYXUFF-UHFFFAOYSA-N |
| XLogP | 1.71 |
| TPSA | 70.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.42 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|