C10H6N4O — CID 20723896
2-(3-cyano-1,4-dimethyl-5-oxopyrrol-2-ylidene)propanedinitrile (PubChem CID 20723896) has the molecular formula C10H6N4O and a molecular weight of 198.18 g/mol. Its IUPAC name is 2-(3-cyano-1,4-dimethyl-5-oxopyrrol-2-ylidene)propanedinitrile.
| Compound Name | 2-(3-cyano-1,4-dimethyl-5-oxopyrrol-2-ylidene)propanedinitrile |
|---|---|
| PubChem CID | 20723896 |
| Molecular Formula | C10H6N4O |
| Molecular Weight | 198.18 g/mol |
| Exact Mass | 198.05 |
| IUPAC Name | 2-(3-cyano-1,4-dimethyl-5-oxopyrrol-2-ylidene)propanedinitrile |
| SMILES | CC1=C(C#N)C(=C(C#N)C#N)N(C)C1=O |
| InChI | InChI=1S/C10H6N4O/c1-6-8(5-13)9(7(3-11)4-12)14(2)10(6)15/h1-2H3 |
| InChIKey | OELYFTOGEMBLLY-UHFFFAOYSA-N |
| XLogP | 0.60 |
| TPSA | 91.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 198.18 |
| LogP ≤ 5 | 0.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|