C12H8F13NO — CID 20727676
2-methyl-1-[2-(1,1,2,2,3,3,4,4,5,5,6,6,6-tridecafluorohexyl)aziridin-1-yl]prop-2-en-1-one (PubChem CID 20727676) has the molecular formula C12H8F13NO and a molecular weight of 429.18 g/mol. Its IUPAC name is 2-methyl-1-[2-(1,1,2,2,3,3,4,4,5,5,6,6,6-tridecafluorohexyl)aziridin-1-yl]prop-2-en-1-one.
| Compound Name | 2-methyl-1-[2-(1,1,2,2,3,3,4,4,5,5,6,6,6-tridecafluorohexyl)aziridin-1-yl]prop-2-en-1-one |
|---|---|
| PubChem CID | 20727676 |
| Molecular Formula | C12H8F13NO |
| Molecular Weight | 429.18 g/mol |
| Exact Mass | 429.04 |
| IUPAC Name | 2-methyl-1-[2-(1,1,2,2,3,3,4,4,5,5,6,6,6-tridecafluorohexyl)aziridin-1-yl]prop-2-en-1-one |
| SMILES | C=C(C)C(=O)N1CC1C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C12H8F13NO/c1-4(2)6(27)26-3-5(26)7(13,14)8(15,16)9(17,18)10(19,20)11(21,22)12(23,24)25/h5H,1,3H2,2H3 |
| InChIKey | FGSUWLMCTVHGGC-UHFFFAOYSA-N |
| XLogP | 4.51 |
| TPSA | 20.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.18 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|