C22H38N2O2S — CID 20731674
[2,5-dibutoxy-4-(2-ethylhexylsulfanyl)phenyl]diazene (PubChem CID 20731674) has the molecular formula C22H38N2O2S and a molecular weight of 394.63 g/mol. Its IUPAC name is [2,5-dibutoxy-4-(2-ethylhexylsulfanyl)phenyl]diazene.
| Compound Name | [2,5-dibutoxy-4-(2-ethylhexylsulfanyl)phenyl]diazene |
|---|---|
| PubChem CID | 20731674 |
| Molecular Formula | C22H38N2O2S |
| Molecular Weight | 394.63 g/mol |
| Exact Mass | 394.27 |
| IUPAC Name | [2,5-dibutoxy-4-(2-ethylhexylsulfanyl)phenyl]diazene |
| SMILES | [H]/N=N/c1cc(OCCCC)c(SCC(CC)CCCC)cc1OCCCC |
| InChI | InChI=1S/C22H38N2O2S/c1-5-9-12-18(8-4)17-27-22-16-20(25-13-10-6-2)19(24-23)15-21(22)26-14-11-7-3/h15-16,18,23H,5-14,17H2,1-4H3/b24-23+ |
| InChIKey | JVRAPASAPZWGOY-WCWDXBQESA-N |
| XLogP | 8.02 |
| TPSA | 54.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.63 |
| LogP ≤ 5 | 8.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|