C17H14O9 — CID 20733049
2-[(2-carboxyphenyl)methylperoxymethoxycarbonyl]-4-hydroxybenzoic acid (PubChem CID 20733049) has the molecular formula C17H14O9 and a molecular weight of 362.29 g/mol. Its IUPAC name is 2-[(2-carboxyphenyl)methylperoxymethoxycarbonyl]-4-hydroxybenzoic acid.
| Compound Name | 2-[(2-carboxyphenyl)methylperoxymethoxycarbonyl]-4-hydroxybenzoic acid |
|---|---|
| PubChem CID | 20733049 |
| Molecular Formula | C17H14O9 |
| Molecular Weight | 362.29 g/mol |
| Exact Mass | 362.06 |
| IUPAC Name | 2-[(2-carboxyphenyl)methylperoxymethoxycarbonyl]-4-hydroxybenzoic acid |
| SMILES | O=C(O)c1ccccc1COOCOC(=O)c1cc(O)ccc1C(=O)O |
| InChI | InChI=1S/C17H14O9/c18-11-5-6-13(16(21)22)14(7-11)17(23)24-9-26-25-8-10-3-1-2-4-12(10)15(19)20/h1-7,18H,8-9H2,(H,19,20)(H,21,22) |
| InChIKey | OGAWNRLCWJUQPD-UHFFFAOYSA-N |
| XLogP | 2.05 |
| TPSA | 139.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.29 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|