C29H18Cl6N2O6 — CID 20733257
2-[[4-[[4-[(2-carboxy-3,6-dichlorobenzoyl)amino]-3-chlorophenyl]methyl]-2-chloroanilino]oxymethyl]-3,6-dichlorobenzoic acid (PubChem CID 20733257) has the molecular formula C29H18Cl6N2O6 and a molecular weight of 703.19 g/mol. Its IUPAC name is 2-[[4-[[4-[(2-carboxy-3,6-dichlorobenzoyl)amino]-3-chlorophenyl]methyl]-2-chloroanilino]oxymethyl]-3,6-dichlorobenzoic acid.
| Compound Name | 2-[[4-[[4-[(2-carboxy-3,6-dichlorobenzoyl)amino]-3-chlorophenyl]methyl]-2-chloroanilino]oxymethyl]-3,6-dichlorobenzoic acid |
|---|---|
| PubChem CID | 20733257 |
| Molecular Formula | C29H18Cl6N2O6 |
| Molecular Weight | 703.19 g/mol |
| Exact Mass | 699.93 |
| IUPAC Name | 2-[[4-[[4-[(2-carboxy-3,6-dichlorobenzoyl)amino]-3-chlorophenyl]methyl]-2-chloroanilino]oxymethyl]-3,6-dichlorobenzoic acid |
| SMILES | O=C(O)c1c(Cl)ccc(Cl)c1CONc1ccc(Cc2ccc(NC(=O)c3c(Cl)ccc(Cl)c3C(=O)O)c(Cl)c2)cc1Cl |
| InChI | InChI=1S/C29H18Cl6N2O6/c30-16-3-4-17(31)24(28(39)40)15(16)12-43-37-23-8-2-14(11-21(23)35)9-13-1-7-22(20(34)10-13)36-27(38)25-18(32)5-6-19(33)26(25)29(41)42/h1-8,10-11,37H,9,12H2,(H,36,38)(H,39,40)(H,41,42) |
| InChIKey | FTOWDCBKZQPXLL-UHFFFAOYSA-N |
| XLogP | 9.39 |
| TPSA | 124.96 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 703.19 |
| LogP ≤ 5 | 9.39 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|