C28H20Cl2N2O8 — CID 20733272
2-[[4-[4-[(2-carboxy-4-hydroxybenzoyl)amino]-3-chlorophenyl]-2-chloroanilino]oxymethyl]-5-hydroxybenzoic acid (PubChem CID 20733272) has the molecular formula C28H20Cl2N2O8 and a molecular weight of 583.38 g/mol. Its IUPAC name is 2-[[4-[4-[(2-carboxy-4-hydroxybenzoyl)amino]-3-chlorophenyl]-2-chloroanilino]oxymethyl]-5-hydroxybenzoic acid.
| Compound Name | 2-[[4-[4-[(2-carboxy-4-hydroxybenzoyl)amino]-3-chlorophenyl]-2-chloroanilino]oxymethyl]-5-hydroxybenzoic acid |
|---|---|
| PubChem CID | 20733272 |
| Molecular Formula | C28H20Cl2N2O8 |
| Molecular Weight | 583.38 g/mol |
| Exact Mass | 582.06 |
| IUPAC Name | 2-[[4-[4-[(2-carboxy-4-hydroxybenzoyl)amino]-3-chlorophenyl]-2-chloroanilino]oxymethyl]-5-hydroxybenzoic acid |
| SMILES | O=C(O)c1cc(O)ccc1CONc1ccc(-c2ccc(NC(=O)c3ccc(O)cc3C(=O)O)c(Cl)c2)cc1Cl |
| InChI | InChI=1S/C28H20Cl2N2O8/c29-22-9-14(2-7-24(22)31-26(35)19-6-5-18(34)12-21(19)28(38)39)15-3-8-25(23(30)10-15)32-40-13-16-1-4-17(33)11-20(16)27(36)37/h1-12,32-34H,13H2,(H,31,35)(H,36,37)(H,38,39) |
| InChIKey | ZUPCHCIFZKSUGN-UHFFFAOYSA-N |
| XLogP | 6.26 |
| TPSA | 165.42 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 40 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 583.38 |
| LogP ≤ 5 | 6.26 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|