C15H20N2O8S2 — CID 20739157
bis(2-hydroxyethylamino) 2-methylnaphthalene-1,5-disulfonate (PubChem CID 20739157) has the molecular formula C15H20N2O8S2 and a molecular weight of 420.47 g/mol. Its IUPAC name is bis(2-hydroxyethylamino) 2-methylnaphthalene-1,5-disulfonate.
| Compound Name | bis(2-hydroxyethylamino) 2-methylnaphthalene-1,5-disulfonate |
|---|---|
| PubChem CID | 20739157 |
| Molecular Formula | C15H20N2O8S2 |
| Molecular Weight | 420.47 g/mol |
| Exact Mass | 420.07 |
| IUPAC Name | bis(2-hydroxyethylamino) 2-methylnaphthalene-1,5-disulfonate |
| SMILES | Cc1ccc2c(S(=O)(=O)ONCCO)cccc2c1S(=O)(=O)ONCCO |
| InChI | InChI=1S/C15H20N2O8S2/c1-11-5-6-12-13(15(11)27(22,23)25-17-8-10-19)3-2-4-14(12)26(20,21)24-16-7-9-18/h2-6,16-19H,7-10H2,1H3 |
| InChIKey | XCXMODAQPWUBIY-UHFFFAOYSA-N |
| XLogP | -0.45 |
| TPSA | 151.26 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.47 |
| LogP ≤ 5 | -0.45 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|