About 1-methanidyl-10-methylidene-1,10-phenanthrolin-10-ium
1-methanidyl-10-methylidene-1,10-phenanthrolin-10-ium (PubChem CID 20740736) has the molecular formula C14H12N2
and a molecular weight of 208.26 g/mol. Its IUPAC name is 1-methanidyl-10-methylidene-1,10-phenanthrolin-10-ium.
Molecular Properties
| Compound Name | 1-methanidyl-10-methylidene-1,10-phenanthrolin-10-ium |
| PubChem CID | 20740736 |
| Molecular Formula | C14H12N2 |
| Molecular Weight | 208.26 g/mol |
| Exact Mass | 208.10 |
| IUPAC Name | 1-methanidyl-10-methylidene-1,10-phenanthrolin-10-ium |
| SMILES | C=[n+]1cccc2ccc3c(c21)N([CH2-])C=CC=3 |
| InChI | InChI=1S/C14H12N2/c1-15-9-3-5-11-7-8-12-6-4-10-16(2)14(12)13(11)15/h3-10H,1-2H2 |
| InChIKey | HLGJDDHJDROWHT-UHFFFAOYSA-N |
| XLogP | 1.67 |
| TPSA | 9.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 208.26 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|
Analyze 1-methanidyl-10-methylidene-1,10-phenanthrolin-10-ium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-methanidyl-10-methylidene-1,10-phenanthrolin-10-ium?
The IUPAC name of 1-methanidyl-10-methylidene-1,10-phenanthrolin-10-ium (CID 20740736) is 1-methanidyl-10-methylidene-1,10-phenanthrolin-10-ium.
What is the SMILES notation for 1-methanidyl-10-methylidene-1,10-phenanthrolin-10-ium?
The canonical SMILES for 1-methanidyl-10-methylidene-1,10-phenanthrolin-10-ium is C=[n+]1cccc2ccc3c(c21)N([CH2-])C=CC=3.
What is the InChIKey of 1-methanidyl-10-methylidene-1,10-phenanthrolin-10-ium?
The InChIKey is HLGJDDHJDROWHT-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H12N2/c1-15-9-3-5-11-7-8-12-6-4-10-16(2)14(12)13(11)15/h3-10H,1-2H2.
What are the key properties of 1-methanidyl-10-methylidene-1,10-phenanthrolin-10-ium?
1-methanidyl-10-methylidene-1,10-phenanthrolin-10-ium has a molecular weight of 208.26 g/mol, XLogP of 1.67, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-methanidyl-10-methylidene-1,10-phenanthrolin-10-ium is sourced from PubChem (CID 20740736), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).