C12H17Y+2 — CID 20744997
2,3-dimethylbutylbenzene;yttrium(3+) (PubChem CID 20744997) has the molecular formula C12H17Y+2 and a molecular weight of 250.17 g/mol. Its IUPAC name is 2,3-dimethylbutylbenzene;yttrium(3+).
| Compound Name | 2,3-dimethylbutylbenzene;yttrium(3+) |
|---|---|
| PubChem CID | 20744997 |
| Molecular Formula | C12H17Y+2 |
| Molecular Weight | 250.17 g/mol |
| Exact Mass | 250.04 |
| IUPAC Name | 2,3-dimethylbutylbenzene;yttrium(3+) |
| SMILES | C[C-](C)C(C)Cc1ccccc1.[Y+3] |
| InChI | InChI=1S/C12H17.Y/c1-10(2)11(3)9-12-7-5-4-6-8-12;/h4-8,11H,9H2,1-3H3;/q-1;+3 |
| InChIKey | FJYROGRUJCXLMR-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.17 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|