About 1-(3,4-difluorobenzene-6-id-1-yl)pyrazole;yttrium;zinc
1-(3,4-difluorobenzene-6-id-1-yl)pyrazole;yttrium;zinc (PubChem CID 20747767) has the molecular formula C9H5F2N2YZn-
and a molecular weight of 333.45 g/mol. Its IUPAC name is 1-(3,4-difluorobenzene-6-id-1-yl)pyrazole;yttrium;zinc.
Molecular Properties
| Compound Name | 1-(3,4-difluorobenzene-6-id-1-yl)pyrazole;yttrium;zinc |
| PubChem CID | 20747767 |
| Molecular Formula | C9H5F2N2YZn- |
| Molecular Weight | 333.45 g/mol |
| Exact Mass | 331.88 |
| IUPAC Name | 1-(3,4-difluorobenzene-6-id-1-yl)pyrazole;yttrium;zinc |
| SMILES | Fc1c[c-]c(-n2cccn2)cc1F.[Y].[Zn] |
| InChI | InChI=1S/C9H5F2N2.Y.Zn/c10-8-3-2-7(6-9(8)11)13-5-1-4-12-13;;/h1,3-6H;;/q-1;; |
| InChIKey | PERUKINYUFMVHQ-UHFFFAOYSA-N |
| XLogP | 1.95 |
| TPSA | 17.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 333.45 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze 1-(3,4-difluorobenzene-6-id-1-yl)pyrazole;yttrium;zinc with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(3,4-difluorobenzene-6-id-1-yl)pyrazole;yttrium;zinc?
The IUPAC name of 1-(3,4-difluorobenzene-6-id-1-yl)pyrazole;yttrium;zinc (CID 20747767) is 1-(3,4-difluorobenzene-6-id-1-yl)pyrazole;yttrium;zinc.
What is the SMILES notation for 1-(3,4-difluorobenzene-6-id-1-yl)pyrazole;yttrium;zinc?
The canonical SMILES for 1-(3,4-difluorobenzene-6-id-1-yl)pyrazole;yttrium;zinc is Fc1c[c-]c(-n2cccn2)cc1F.[Y].[Zn].
What is the InChIKey of 1-(3,4-difluorobenzene-6-id-1-yl)pyrazole;yttrium;zinc?
The InChIKey is PERUKINYUFMVHQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H5F2N2.Y.Zn/c10-8-3-2-7(6-9(8)11)13-5-1-4-12-13;;/h1,3-6H;;/q-1;;.
What are the key properties of 1-(3,4-difluorobenzene-6-id-1-yl)pyrazole;yttrium;zinc?
1-(3,4-difluorobenzene-6-id-1-yl)pyrazole;yttrium;zinc has a molecular weight of 333.45 g/mol, XLogP of 1.95, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(3,4-difluorobenzene-6-id-1-yl)pyrazole;yttrium;zinc is sourced from PubChem (CID 20747767), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).