About 1-phenylpyrazole;platinum
1-phenylpyrazole;platinum (PubChem CID 21044154) has the molecular formula C9H7N2Pt-
and a molecular weight of 338.25 g/mol. Its IUPAC name is 1-phenylpyrazole;platinum.
Molecular Properties
| Compound Name | 1-phenylpyrazole;platinum |
| PubChem CID | 21044154 |
| Molecular Formula | C9H7N2Pt- |
| Molecular Weight | 338.25 g/mol |
| Exact Mass | 338.03 |
| IUPAC Name | 1-phenylpyrazole;platinum |
| SMILES | [Pt].[c-]1ccccc1-n1cccn1 |
| InChI | InChI=1S/C9H7N2.Pt/c1-2-5-9(6-3-1)11-8-4-7-10-11;/h1-5,7-8H;/q-1; |
| InChIKey | IRGZYELOZKFJFX-UHFFFAOYSA-N |
| XLogP | 1.67 |
| TPSA | 17.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 338.25 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|
Analyze 1-phenylpyrazole;platinum with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-phenylpyrazole;platinum?
The IUPAC name of 1-phenylpyrazole;platinum (CID 21044154) is 1-phenylpyrazole;platinum.
What is the SMILES notation for 1-phenylpyrazole;platinum?
The canonical SMILES for 1-phenylpyrazole;platinum is [Pt].[c-]1ccccc1-n1cccn1.
What is the InChIKey of 1-phenylpyrazole;platinum?
The InChIKey is IRGZYELOZKFJFX-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H7N2.Pt/c1-2-5-9(6-3-1)11-8-4-7-10-11;/h1-5,7-8H;/q-1;.
What are the key properties of 1-phenylpyrazole;platinum?
1-phenylpyrazole;platinum has a molecular weight of 338.25 g/mol, XLogP of 1.67, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-phenylpyrazole;platinum is sourced from PubChem (CID 21044154), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).