C9H5F2IrN2- — CID 21044150
1-(2,4-difluorobenzene-6-id-1-yl)pyrazole;iridium (PubChem CID 21044150) has the molecular formula C9H5F2IrN2- and a molecular weight of 371.37 g/mol. Its IUPAC name is 1-(2,4-difluorobenzene-6-id-1-yl)pyrazole;iridium.
| Compound Name | 1-(2,4-difluorobenzene-6-id-1-yl)pyrazole;iridium |
|---|---|
| PubChem CID | 21044150 |
| Molecular Formula | C9H5F2IrN2- |
| Molecular Weight | 371.37 g/mol |
| Exact Mass | 372.01 |
| IUPAC Name | 1-(2,4-difluorobenzene-6-id-1-yl)pyrazole;iridium |
| SMILES | Fc1c[c-]c(-n2cccn2)c(F)c1.[Ir] |
| InChI | InChI=1S/C9H5F2N2.Ir/c10-7-2-3-9(8(11)6-7)13-5-1-4-12-13;/h1-2,4-6H;/q-1; |
| InChIKey | ZQCNPUDIXSPBOD-UHFFFAOYSA-N |
| XLogP | 1.95 |
| TPSA | 17.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.37 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|