C24H19N3O2 — CID 20752022
8-(2,4-dimethylanilino)-3-methylbenzo[e]perimidine-2,7-dione (PubChem CID 20752022) has the molecular formula C24H19N3O2 and a molecular weight of 381.44 g/mol. Its IUPAC name is 8-(2,4-dimethylanilino)-3-methylbenzo[e]perimidine-2,7-dione.
| Compound Name | 8-(2,4-dimethylanilino)-3-methylbenzo[e]perimidine-2,7-dione |
|---|---|
| PubChem CID | 20752022 |
| Molecular Formula | C24H19N3O2 |
| Molecular Weight | 381.44 g/mol |
| Exact Mass | 381.15 |
| IUPAC Name | 8-(2,4-dimethylanilino)-3-methylbenzo[e]perimidine-2,7-dione |
| SMILES | Cc1ccc(Nc2cccc3c2C(=O)c2cccc4c2c-3nc(=O)n4C)c(C)c1 |
| InChI | InChI=1S/C24H19N3O2/c1-13-10-11-17(14(2)12-13)25-18-8-4-6-15-20(18)23(28)16-7-5-9-19-21(16)22(15)26-24(29)27(19)3/h4-12,25H,1-3H3 |
| InChIKey | RAMTWJCYRMUJHY-UHFFFAOYSA-N |
| XLogP | 4.51 |
| TPSA | 63.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.44 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anthranil_one_A(38)', 'substructure': 'N/A'} |
|---|