C34H31N3O2 — CID 20752025
4-(4-tert-butyl-2-methylphenoxy)-2-(2,4-dimethylanilino)benzo[e]perimidin-7-one (PubChem CID 20752025) has the molecular formula C34H31N3O2 and a molecular weight of 513.64 g/mol. Its IUPAC name is 4-(4-tert-butyl-2-methylphenoxy)-2-(2,4-dimethylanilino)benzo[e]perimidin-7-one.
| Compound Name | 4-(4-tert-butyl-2-methylphenoxy)-2-(2,4-dimethylanilino)benzo[e]perimidin-7-one |
|---|---|
| PubChem CID | 20752025 |
| Molecular Formula | C34H31N3O2 |
| Molecular Weight | 513.64 g/mol |
| Exact Mass | 513.24 |
| IUPAC Name | 4-(4-tert-butyl-2-methylphenoxy)-2-(2,4-dimethylanilino)benzo[e]perimidin-7-one |
| SMILES | Cc1ccc(Nc2nc3c4c(ccc(Oc5ccc(C(C)(C)C)cc5C)c4n2)C(=O)c2ccccc2-3)c(C)c1 |
| InChI | InChI=1S/C34H31N3O2/c1-19-11-14-26(20(2)17-19)35-33-36-30-23-9-7-8-10-24(23)32(38)25-13-16-28(31(37-33)29(25)30)39-27-15-12-22(18-21(27)3)34(4,5)6/h7-18H,1-6H3,(H,35,36,37) |
| InChIKey | MVSHOVUIWUFPGW-UHFFFAOYSA-N |
| XLogP | 8.60 |
| TPSA | 64.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 513.64 |
| LogP ≤ 5 | 8.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |