C54H51NO6 — CID 20754204
[4-[1-(4-methoxyphenyl)-1-[4-(4-methyl-N-(4-methylphenyl)anilino)phenyl]ethyl]phenyl] 2-[4-[2-(4-acetyloxyphenyl)propan-2-yl]phenoxy]acetate (PubChem CID 20754204) has the molecular formula C54H51NO6 and a molecular weight of 810.00 g/mol. Its IUPAC name is [4-[1-(4-methoxyphenyl)-1-[4-(4-methyl-N-(4-methylphenyl)anilino)phenyl]ethyl]phenyl] 2-[4-[2-(4-acetyloxyphenyl)propan-2-yl]phenoxy]acetate.
| Compound Name | [4-[1-(4-methoxyphenyl)-1-[4-(4-methyl-N-(4-methylphenyl)anilino)phenyl]ethyl]phenyl] 2-[4-[2-(4-acetyloxyphenyl)propan-2-yl]phenoxy]acetate |
|---|---|
| PubChem CID | 20754204 |
| Molecular Formula | C54H51NO6 |
| Molecular Weight | 810.00 g/mol |
| Exact Mass | 809.37 |
| IUPAC Name | [4-[1-(4-methoxyphenyl)-1-[4-(4-methyl-N-(4-methylphenyl)anilino)phenyl]ethyl]phenyl] 2-[4-[2-(4-acetyloxyphenyl)propan-2-yl]phenoxy]acetate |
| SMILES | COc1ccc(C(C)(c2ccc(OC(=O)COc3ccc(C(C)(C)c4ccc(OC(C)=O)cc4)cc3)cc2)c2ccc(N(c3ccc(C)cc3)c3ccc(C)cc3)cc2)cc1 |
| InChI | InChI=1S/C54H51NO6/c1-37-8-22-45(23-9-37)55(46-24-10-38(2)11-25-46)47-26-12-42(13-27-47)54(6,43-18-28-48(58-7)29-19-43)44-20-34-51(35-21-44)61-52(57)36-59-49-30-14-40(15-31-49)53(4,5)41-16-32-50(33-17-41)60-39(3)56/h8-35H,36H2,1-7H3 |
| InChIKey | JGMJEXDMYBXXGZ-UHFFFAOYSA-N |
| XLogP | 12.37 |
| TPSA | 74.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 61 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 810.00 |
| LogP ≤ 5 | 12.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|