C32H46N6O2 — CID 20755713
N-[[3-[[[amino-(2-piperidin-1-ylethylcarbamoylamino)methylidene]amino]methyl]cyclohexyl]methyl]-2,3-diphenylpropanamide (PubChem CID 20755713) has the molecular formula C32H46N6O2 and a molecular weight of 546.76 g/mol. Its IUPAC name is N-[[3-[[[amino-(2-piperidin-1-ylethylcarbamoylamino)methylidene]amino]methyl]cyclohexyl]methyl]-2,3-diphenylpropanamide.
| Compound Name | N-[[3-[[[amino-(2-piperidin-1-ylethylcarbamoylamino)methylidene]amino]methyl]cyclohexyl]methyl]-2,3-diphenylpropanamide |
|---|---|
| PubChem CID | 20755713 |
| Molecular Formula | C32H46N6O2 |
| Molecular Weight | 546.76 g/mol |
| Exact Mass | 546.37 |
| IUPAC Name | N-[[3-[[[amino-(2-piperidin-1-ylethylcarbamoylamino)methylidene]amino]methyl]cyclohexyl]methyl]-2,3-diphenylpropanamide |
| SMILES | N/C(=N\CC1CCCC(CNC(=O)C(Cc2ccccc2)c2ccccc2)C1)NC(=O)NCCN1CCCCC1 |
| InChI | InChI=1S/C32H46N6O2/c33-31(37-32(40)34-17-20-38-18-8-3-9-19-38)36-24-27-14-10-13-26(21-27)23-35-30(39)29(28-15-6-2-7-16-28)22-25-11-4-1-5-12-25/h1-2,4-7,11-12,15-16,26-27,29H,3,8-10,13-14,17-24H2,(H,35,39)(H4,33,34,36,37,40) |
| InChIKey | HPQKMYAESACKHV-UHFFFAOYSA-N |
| XLogP | 4.04 |
| TPSA | 111.85 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 546.76 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|