C33H46N6O4 — CID 20755746
ethyl 4-[[N'-[[3-[(2,3-diphenylpropanoylamino)methyl]cyclohexyl]methyl]carbamimidoyl]carbamoylamino]piperidine-1-carboxylate (PubChem CID 20755746) has the molecular formula C33H46N6O4 and a molecular weight of 590.77 g/mol. Its IUPAC name is ethyl 4-[[N'-[[3-[(2,3-diphenylpropanoylamino)methyl]cyclohexyl]methyl]carbamimidoyl]carbamoylamino]piperidine-1-carboxylate.
| Compound Name | ethyl 4-[[N'-[[3-[(2,3-diphenylpropanoylamino)methyl]cyclohexyl]methyl]carbamimidoyl]carbamoylamino]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 20755746 |
| Molecular Formula | C33H46N6O4 |
| Molecular Weight | 590.77 g/mol |
| Exact Mass | 590.36 |
| IUPAC Name | ethyl 4-[[N'-[[3-[(2,3-diphenylpropanoylamino)methyl]cyclohexyl]methyl]carbamimidoyl]carbamoylamino]piperidine-1-carboxylate |
| SMILES | CCOC(=O)N1CCC(NC(=O)N/C(N)=N/CC2CCCC(CNC(=O)C(Cc3ccccc3)c3ccccc3)C2)CC1 |
| InChI | InChI=1S/C33H46N6O4/c1-2-43-33(42)39-18-16-28(17-19-39)37-32(41)38-31(34)36-23-26-13-9-12-25(20-26)22-35-30(40)29(27-14-7-4-8-15-27)21-24-10-5-3-6-11-24/h3-8,10-11,14-15,25-26,28-29H,2,9,12-13,16-23H2,1H3,(H,35,40)(H4,34,36,37,38,41) |
| InChIKey | RSVNASLWNPNZDM-UHFFFAOYSA-N |
| XLogP | 4.17 |
| TPSA | 138.15 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 590.77 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|