C26H15F5N2O6S — CID 20758666
6,7,19,20-tetrafluoro-23-[6-(fluoromethyl)-3,4,5-trihydroxyoxan-2-yl]-3-thia-13,23-diazahexacyclo[14.7.0.02,10.04,9.011,15.017,22]tricosa-1,4,6,8,10,15,17,19,21-nonaene-12,14-dione (PubChem CID 20758666) has the molecular formula C26H15F5N2O6S and a molecular weight of 578.47 g/mol. Its IUPAC name is 6,7,19,20-tetrafluoro-23-[6-(fluoromethyl)-3,4,5-trihydroxyoxan-2-yl]-3-thia-13,23-diazahexacyclo[14.7.0.02,10.04,9.011,15.017,22]tricosa-1,4,6,8,10,15,17,19,21-nonaene-12,14-dione.
| Compound Name | 6,7,19,20-tetrafluoro-23-[6-(fluoromethyl)-3,4,5-trihydroxyoxan-2-yl]-3-thia-13,23-diazahexacyclo[14.7.0.02,10.04,9.011,15.017,22]tricosa-1,4,6,8,10,15,17,19,21-nonaene-12,14-dione |
|---|---|
| PubChem CID | 20758666 |
| Molecular Formula | C26H15F5N2O6S |
| Molecular Weight | 578.47 g/mol |
| Exact Mass | 578.06 |
| IUPAC Name | 6,7,19,20-tetrafluoro-23-[6-(fluoromethyl)-3,4,5-trihydroxyoxan-2-yl]-3-thia-13,23-diazahexacyclo[14.7.0.02,10.04,9.011,15.017,22]tricosa-1,4,6,8,10,15,17,19,21-nonaene-12,14-dione |
| SMILES | O=C1NC(=O)c2c1c1c3cc(F)c(F)cc3sc1c1c2c2cc(F)c(F)cc2n1C1OC(CF)C(O)C(O)C1O |
| InChI | InChI=1S/C26H15F5N2O6S/c27-5-13-20(34)21(35)22(36)26(39-13)33-12-3-10(30)8(28)1-6(12)15-17-18(25(38)32-24(17)37)16-7-2-9(29)11(31)4-14(7)40-23(16)19(15)33/h1-4,13,20-22,26,34-36H,5H2,(H,32,37,38) |
| InChIKey | LEHQLDQOIPATGT-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 121.02 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 578.47 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|