C22H32N4O2 — CID 20760339
1-[(1-benzylpiperidin-4-yl)methylamino]-3-(2,3-diaminophenoxy)propan-2-ol (PubChem CID 20760339) has the molecular formula C22H32N4O2 and a molecular weight of 384.52 g/mol. Its IUPAC name is 1-[(1-benzylpiperidin-4-yl)methylamino]-3-(2,3-diaminophenoxy)propan-2-ol.
| Compound Name | 1-[(1-benzylpiperidin-4-yl)methylamino]-3-(2,3-diaminophenoxy)propan-2-ol |
|---|---|
| PubChem CID | 20760339 |
| Molecular Formula | C22H32N4O2 |
| Molecular Weight | 384.52 g/mol |
| Exact Mass | 384.25 |
| IUPAC Name | 1-[(1-benzylpiperidin-4-yl)methylamino]-3-(2,3-diaminophenoxy)propan-2-ol |
| SMILES | Nc1cccc(OCC(O)CNCC2CCN(Cc3ccccc3)CC2)c1N |
| InChI | InChI=1S/C22H32N4O2/c23-20-7-4-8-21(22(20)24)28-16-19(27)14-25-13-17-9-11-26(12-10-17)15-18-5-2-1-3-6-18/h1-8,17,19,25,27H,9-16,23-24H2 |
| InChIKey | AXJYLVAPDRSVLU-UHFFFAOYSA-N |
| XLogP | 2.09 |
| TPSA | 96.77 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.52 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|