C11H10F6 — CID 20760925
2-(1,1,1,3,3,3-hexafluoro-2-methylpropan-2-yl)bicyclo[2.2.1]hepta-2,5-diene (PubChem CID 20760925) has the molecular formula C11H10F6 and a molecular weight of 256.19 g/mol. Its IUPAC name is 2-(1,1,1,3,3,3-hexafluoro-2-methylpropan-2-yl)bicyclo[2.2.1]hepta-2,5-diene.
| Compound Name | 2-(1,1,1,3,3,3-hexafluoro-2-methylpropan-2-yl)bicyclo[2.2.1]hepta-2,5-diene |
|---|---|
| PubChem CID | 20760925 |
| Molecular Formula | C11H10F6 |
| Molecular Weight | 256.19 g/mol |
| Exact Mass | 256.07 |
| IUPAC Name | 2-(1,1,1,3,3,3-hexafluoro-2-methylpropan-2-yl)bicyclo[2.2.1]hepta-2,5-diene |
| SMILES | CC(C1=CC2C=CC1C2)(C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C11H10F6/c1-9(10(12,13)14,11(15,16)17)8-5-6-2-3-7(8)4-6/h2-3,5-7H,4H2,1H3 |
| InChIKey | ZQLIBKBBQWRGBG-UHFFFAOYSA-N |
| XLogP | 4.25 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.19 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|