C12H4F18 — CID 550605
1,3,3,4,5,6-hexakis(trifluoromethyl)cyclohexene (PubChem CID 550605) has the molecular formula C12H4F18 and a molecular weight of 490.13 g/mol. Its IUPAC name is 1,3,3,4,5,6-hexakis(trifluoromethyl)cyclohexene.
| Compound Name | 1,3,3,4,5,6-hexakis(trifluoromethyl)cyclohexene |
|---|---|
| PubChem CID | 550605 |
| Molecular Formula | C12H4F18 |
| Molecular Weight | 490.13 g/mol |
| Exact Mass | 490.00 |
| IUPAC Name | 1,3,3,4,5,6-hexakis(trifluoromethyl)cyclohexene |
| SMILES | FC(F)(F)C1=CC(C(F)(F)F)(C(F)(F)F)C(C(F)(F)F)C(C(F)(F)F)C1C(F)(F)F |
| InChI | InChI=1S/C12H4F18/c13-7(14,15)2-1-6(11(25,26)27,12(28,29)30)5(10(22,23)24)4(9(19,20)21)3(2)8(16,17)18/h1,3-5H |
| InChIKey | LLUKTGMAZHTJJG-UHFFFAOYSA-N |
| XLogP | 7.14 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.13 |
| LogP ≤ 5 | 7.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|