C15H22O7 — CID 20761284
2-(2-methylbutanoyloxy)ethyl 3-(hydroperoxymethyl)-7-oxabicyclo[2.2.1]hept-5-ene-2-carboxylate (PubChem CID 20761284) has the molecular formula C15H22O7 and a molecular weight of 314.33 g/mol. Its IUPAC name is 2-(2-methylbutanoyloxy)ethyl 3-(hydroperoxymethyl)-7-oxabicyclo[2.2.1]hept-5-ene-2-carboxylate.
| Compound Name | 2-(2-methylbutanoyloxy)ethyl 3-(hydroperoxymethyl)-7-oxabicyclo[2.2.1]hept-5-ene-2-carboxylate |
|---|---|
| PubChem CID | 20761284 |
| Molecular Formula | C15H22O7 |
| Molecular Weight | 314.33 g/mol |
| Exact Mass | 314.14 |
| IUPAC Name | 2-(2-methylbutanoyloxy)ethyl 3-(hydroperoxymethyl)-7-oxabicyclo[2.2.1]hept-5-ene-2-carboxylate |
| SMILES | CCC(C)C(=O)OCCOC(=O)C1C2C=CC(O2)C1COO |
| InChI | InChI=1S/C15H22O7/c1-3-9(2)14(16)19-6-7-20-15(17)13-10(8-21-18)11-4-5-12(13)22-11/h4-5,9-13,18H,3,6-8H2,1-2H3 |
| InChIKey | DSZDEEHUUHHLNY-UHFFFAOYSA-N |
| XLogP | 1.18 |
| TPSA | 91.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.33 |
| LogP ≤ 5 | 1.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|