C26H54O6Si4 — CID 59881169
1-O-[2-(2-methylbutanoyloxy)ethyl] 2-O-[2-tris(trimethylsilyl)silylethyl] cyclohexane-1,2-dicarboxylate (PubChem CID 59881169) has the molecular formula C26H54O6Si4 and a molecular weight of 575.06 g/mol. Its IUPAC name is 1-O-[2-(2-methylbutanoyloxy)ethyl] 2-O-[2-tris(trimethylsilyl)silylethyl] cyclohexane-1,2-dicarboxylate.
| Compound Name | 1-O-[2-(2-methylbutanoyloxy)ethyl] 2-O-[2-tris(trimethylsilyl)silylethyl] cyclohexane-1,2-dicarboxylate |
|---|---|
| PubChem CID | 59881169 |
| Molecular Formula | C26H54O6Si4 |
| Molecular Weight | 575.06 g/mol |
| Exact Mass | 574.30 |
| IUPAC Name | 1-O-[2-(2-methylbutanoyloxy)ethyl] 2-O-[2-tris(trimethylsilyl)silylethyl] cyclohexane-1,2-dicarboxylate |
| SMILES | CCC(C)C(=O)OCCOC(=O)C1CCCCC1C(=O)OCC[Si]([Si](C)(C)C)([Si](C)(C)C)[Si](C)(C)C |
| InChI | InChI=1S/C26H54O6Si4/c1-12-21(2)24(27)30-17-18-31-25(28)22-15-13-14-16-23(22)26(29)32-19-20-36(33(3,4)5,34(6,7)8)35(9,10)11/h21-23H,12-20H2,1-11H3 |
| InChIKey | UTMMCKYOIYNKCP-UHFFFAOYSA-N |
| XLogP | 6.17 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 575.06 |
| LogP ≤ 5 | 6.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|