About 2-[[1,2-bis(4-fluorophenyl)-2-(2-sulfanylanilino)ethyl]amino]benzenethiol
2-[[1,2-bis(4-fluorophenyl)-2-(2-sulfanylanilino)ethyl]amino]benzenethiol (PubChem CID 20762520) has the molecular formula C26H22F2N2S2
and a molecular weight of 464.61 g/mol. Its IUPAC name is 2-[[1,2-bis(4-fluorophenyl)-2-(2-sulfanylanilino)ethyl]amino]benzenethiol.
Molecular Properties
| Compound Name | 2-[[1,2-bis(4-fluorophenyl)-2-(2-sulfanylanilino)ethyl]amino]benzenethiol |
| PubChem CID | 20762520 |
| Molecular Formula | C26H22F2N2S2 |
| Molecular Weight | 464.61 g/mol |
| Exact Mass | 464.12 |
| IUPAC Name | 2-[[1,2-bis(4-fluorophenyl)-2-(2-sulfanylanilino)ethyl]amino]benzenethiol |
| SMILES | Fc1ccc(C(Nc2ccccc2S)C(Nc2ccccc2S)c2ccc(F)cc2)cc1 |
| InChI | InChI=1S/C26H22F2N2S2/c27-19-13-9-17(10-14-19)25(29-21-5-1-3-7-23(21)31)26(18-11-15-20(28)16-12-18)30-22-6-2-4-8-24(22)32/h1-16,25-26,29-32H |
| InChIKey | HNLVFTFJTFYTJZ-UHFFFAOYSA-N |
| XLogP | 7.55 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 464.61 |
| LogP ≤ 5 | 7.55 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze 2-[[1,2-bis(4-fluorophenyl)-2-(2-sulfanylanilino)ethyl]amino]benzenethiol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[[1,2-bis(4-fluorophenyl)-2-(2-sulfanylanilino)ethyl]amino]benzenethiol?
The IUPAC name of 2-[[1,2-bis(4-fluorophenyl)-2-(2-sulfanylanilino)ethyl]amino]benzenethiol (CID 20762520) is 2-[[1,2-bis(4-fluorophenyl)-2-(2-sulfanylanilino)ethyl]amino]benzenethiol.
What is the SMILES notation for 2-[[1,2-bis(4-fluorophenyl)-2-(2-sulfanylanilino)ethyl]amino]benzenethiol?
The canonical SMILES for 2-[[1,2-bis(4-fluorophenyl)-2-(2-sulfanylanilino)ethyl]amino]benzenethiol is Fc1ccc(C(Nc2ccccc2S)C(Nc2ccccc2S)c2ccc(F)cc2)cc1.
What is the InChIKey of 2-[[1,2-bis(4-fluorophenyl)-2-(2-sulfanylanilino)ethyl]amino]benzenethiol?
The InChIKey is HNLVFTFJTFYTJZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C26H22F2N2S2/c27-19-13-9-17(10-14-19)25(29-21-5-1-3-7-23(21)31)26(18-11-15-20(28)16-12-18)30-22-6-2-4-8-24(22)32/h1-16,25-26,29-32H.
What are the key properties of 2-[[1,2-bis(4-fluorophenyl)-2-(2-sulfanylanilino)ethyl]amino]benzenethiol?
2-[[1,2-bis(4-fluorophenyl)-2-(2-sulfanylanilino)ethyl]amino]benzenethiol has a molecular weight of 464.61 g/mol, XLogP of 7.55, 7 rotatable bonds, 4 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[[1,2-bis(4-fluorophenyl)-2-(2-sulfanylanilino)ethyl]amino]benzenethiol is sourced from PubChem (CID 20762520), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).