C26H20F4N2S2 — CID 20762530
2-[[1,2-bis(2,4-difluorophenyl)-2-(2-sulfanylanilino)ethyl]amino]benzenethiol (PubChem CID 20762530) has the molecular formula C26H20F4N2S2 and a molecular weight of 500.59 g/mol. Its IUPAC name is 2-[[1,2-bis(2,4-difluorophenyl)-2-(2-sulfanylanilino)ethyl]amino]benzenethiol.
| Compound Name | 2-[[1,2-bis(2,4-difluorophenyl)-2-(2-sulfanylanilino)ethyl]amino]benzenethiol |
|---|---|
| PubChem CID | 20762530 |
| Molecular Formula | C26H20F4N2S2 |
| Molecular Weight | 500.59 g/mol |
| Exact Mass | 500.10 |
| IUPAC Name | 2-[[1,2-bis(2,4-difluorophenyl)-2-(2-sulfanylanilino)ethyl]amino]benzenethiol |
| SMILES | Fc1ccc(C(Nc2ccccc2S)C(Nc2ccccc2S)c2ccc(F)cc2F)c(F)c1 |
| InChI | InChI=1S/C26H20F4N2S2/c27-15-9-11-17(19(29)13-15)25(31-21-5-1-3-7-23(21)33)26(18-12-10-16(28)14-20(18)30)32-22-6-2-4-8-24(22)34/h1-14,25-26,31-34H |
| InChIKey | ZTBLZPLCUKQZNE-UHFFFAOYSA-N |
| XLogP | 7.83 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.59 |
| LogP ≤ 5 | 7.83 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|