C40H46N2O8 — CID 20774240
2,3,3a,4,5,6a-hexahydrofuro[2,3-b]furan-4-yl N-[4-[1,3-benzodioxol-5-ylmethyl(2-methylpropyl)amino]-3-hydroxy-1-[4-(naphthalen-2-ylmethoxy)phenyl]butan-2-yl]carbamate (PubChem CID 20774240) has the molecular formula C40H46N2O8 and a molecular weight of 682.81 g/mol. Its IUPAC name is 2,3,3a,4,5,6a-hexahydrofuro[2,3-b]furan-4-yl N-[4-[1,3-benzodioxol-5-ylmethyl(2-methylpropyl)amino]-3-hydroxy-1-[4-(naphthalen-2-ylmethoxy)phenyl]butan-2-yl]carbamate.
| Compound Name | 2,3,3a,4,5,6a-hexahydrofuro[2,3-b]furan-4-yl N-[4-[1,3-benzodioxol-5-ylmethyl(2-methylpropyl)amino]-3-hydroxy-1-[4-(naphthalen-2-ylmethoxy)phenyl]butan-2-yl]carbamate |
|---|---|
| PubChem CID | 20774240 |
| Molecular Formula | C40H46N2O8 |
| Molecular Weight | 682.81 g/mol |
| Exact Mass | 682.33 |
| IUPAC Name | 2,3,3a,4,5,6a-hexahydrofuro[2,3-b]furan-4-yl N-[4-[1,3-benzodioxol-5-ylmethyl(2-methylpropyl)amino]-3-hydroxy-1-[4-(naphthalen-2-ylmethoxy)phenyl]butan-2-yl]carbamate |
| SMILES | CC(C)CN(Cc1ccc2c(c1)OCO2)CC(O)C(Cc1ccc(OCc2ccc3ccccc3c2)cc1)NC(=O)OC1COC2OCCC12 |
| InChI | InChI=1S/C40H46N2O8/c1-26(2)20-42(21-28-10-14-36-37(19-28)49-25-48-36)22-35(43)34(41-40(44)50-38-24-47-39-33(38)15-16-45-39)18-27-8-12-32(13-9-27)46-23-29-7-11-30-5-3-4-6-31(30)17-29/h3-14,17,19,26,33-35,38-39,43H,15-16,18,20-25H2,1-2H3,(H,41,44) |
| InChIKey | KMQDZPGKNXAWGV-UHFFFAOYSA-N |
| XLogP | 6.07 |
| TPSA | 107.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 682.81 |
| LogP ≤ 5 | 6.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |