C16H26ClN3O2S — CID 20774702
N-[2-(4-chlorophenyl)ethylsulfamoyl]-3-[(2S)-1-methylpyrrolidin-2-yl]propan-1-amine (PubChem CID 20774702) has the molecular formula C16H26ClN3O2S and a molecular weight of 359.92 g/mol. Its IUPAC name is N-[2-(4-chlorophenyl)ethylsulfamoyl]-3-[(2S)-1-methylpyrrolidin-2-yl]propan-1-amine.
| Compound Name | N-[2-(4-chlorophenyl)ethylsulfamoyl]-3-[(2S)-1-methylpyrrolidin-2-yl]propan-1-amine |
|---|---|
| PubChem CID | 20774702 |
| Molecular Formula | C16H26ClN3O2S |
| Molecular Weight | 359.92 g/mol |
| Exact Mass | 359.14 |
| IUPAC Name | N-[2-(4-chlorophenyl)ethylsulfamoyl]-3-[(2S)-1-methylpyrrolidin-2-yl]propan-1-amine |
| SMILES | CN1CCC[C@H]1CCCNS(=O)(=O)NCCc1ccc(Cl)cc1 |
| InChI | InChI=1S/C16H26ClN3O2S/c1-20-13-3-5-16(20)4-2-11-18-23(21,22)19-12-10-14-6-8-15(17)9-7-14/h6-9,16,18-19H,2-5,10-13H2,1H3/t16-/m1/s1 |
| InChIKey | YQUQGWVZUAKUFV-MRXNPFEDSA-N |
| XLogP | 2.18 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.92 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|