C15H24ClN3O2S — CID 20774720
N-[(4-chlorophenyl)methylsulfamoyl]-3-[(2S)-1-methylpyrrolidin-2-yl]propan-1-amine (PubChem CID 20774720) has the molecular formula C15H24ClN3O2S and a molecular weight of 345.90 g/mol. Its IUPAC name is N-[(4-chlorophenyl)methylsulfamoyl]-3-[(2S)-1-methylpyrrolidin-2-yl]propan-1-amine.
| Compound Name | N-[(4-chlorophenyl)methylsulfamoyl]-3-[(2S)-1-methylpyrrolidin-2-yl]propan-1-amine |
|---|---|
| PubChem CID | 20774720 |
| Molecular Formula | C15H24ClN3O2S |
| Molecular Weight | 345.90 g/mol |
| Exact Mass | 345.13 |
| IUPAC Name | N-[(4-chlorophenyl)methylsulfamoyl]-3-[(2S)-1-methylpyrrolidin-2-yl]propan-1-amine |
| SMILES | CN1CCC[C@H]1CCCNS(=O)(=O)NCc1ccc(Cl)cc1 |
| InChI | InChI=1S/C15H24ClN3O2S/c1-19-11-3-5-15(19)4-2-10-17-22(20,21)18-12-13-6-8-14(16)9-7-13/h6-9,15,17-18H,2-5,10-12H2,1H3/t15-/m1/s1 |
| InChIKey | QANKXEXGVNPMGN-OAHLLOKOSA-N |
| XLogP | 2.14 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.90 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|