C26H35N2O+ — CID 2077620
2-(4-phenylphenyl)-N-[(1-piperidin-1-ium-1-ylcyclohexyl)methyl]acetamide (PubChem CID 2077620) has the molecular formula C26H35N2O+ and a molecular weight of 391.58 g/mol. Its IUPAC name is 2-(4-phenylphenyl)-N-[(1-piperidin-1-ium-1-ylcyclohexyl)methyl]acetamide.
| Compound Name | 2-(4-phenylphenyl)-N-[(1-piperidin-1-ium-1-ylcyclohexyl)methyl]acetamide |
|---|---|
| PubChem CID | 2077620 |
| Molecular Formula | C26H35N2O+ |
| Molecular Weight | 391.58 g/mol |
| Exact Mass | 391.27 |
| IUPAC Name | 2-(4-phenylphenyl)-N-[(1-piperidin-1-ium-1-ylcyclohexyl)methyl]acetamide |
| SMILES | O=C(Cc1ccc(-c2ccccc2)cc1)NCC1([NH+]2CCCCC2)CCCCC1 |
| InChI | InChI=1S/C26H34N2O/c29-25(20-22-12-14-24(15-13-22)23-10-4-1-5-11-23)27-21-26(16-6-2-7-17-26)28-18-8-3-9-19-28/h1,4-5,10-15H,2-3,6-9,16-21H2,(H,27,29)/p+1 |
| InChIKey | NWFOQLOBWYCSMF-UHFFFAOYSA-O |
| XLogP | 3.78 |
| TPSA | 33.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.58 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |