C21H33N4O3+ — CID 9328554
N-[(1-morpholin-4-ium-4-ylcyclohexyl)methyl]-3-(phenylcarbamoylamino)propanamide (PubChem CID 9328554) has the molecular formula C21H33N4O3+ and a molecular weight of 389.52 g/mol. Its IUPAC name is N-[(1-morpholin-4-ium-4-ylcyclohexyl)methyl]-3-(phenylcarbamoylamino)propanamide.
| Compound Name | N-[(1-morpholin-4-ium-4-ylcyclohexyl)methyl]-3-(phenylcarbamoylamino)propanamide |
|---|---|
| PubChem CID | 9328554 |
| Molecular Formula | C21H33N4O3+ |
| Molecular Weight | 389.52 g/mol |
| Exact Mass | 389.25 |
| IUPAC Name | N-[(1-morpholin-4-ium-4-ylcyclohexyl)methyl]-3-(phenylcarbamoylamino)propanamide |
| SMILES | O=C(CCNC(=O)Nc1ccccc1)NCC1([NH+]2CCOCC2)CCCCC1 |
| InChI | InChI=1S/C21H32N4O3/c26-19(9-12-22-20(27)24-18-7-3-1-4-8-18)23-17-21(10-5-2-6-11-21)25-13-15-28-16-14-25/h1,3-4,7-8H,2,5-6,9-17H2,(H,23,26)(H2,22,24,27)/p+1 |
| InChIKey | LJPVVWIHYKHYMN-UHFFFAOYSA-O |
| XLogP | 0.93 |
| TPSA | 83.90 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.52 |
| LogP ≤ 5 | 0.93 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |