C28H33N3O2Si — CID 20778076
(3-aminophenyl)-[3-(2-phenylethyl)-1-(2-trimethylsilylethoxymethyl)indazol-6-yl]methanone (PubChem CID 20778076) has the molecular formula C28H33N3O2Si and a molecular weight of 471.68 g/mol. Its IUPAC name is (3-aminophenyl)-[3-(2-phenylethyl)-1-(2-trimethylsilylethoxymethyl)indazol-6-yl]methanone.
| Compound Name | (3-aminophenyl)-[3-(2-phenylethyl)-1-(2-trimethylsilylethoxymethyl)indazol-6-yl]methanone |
|---|---|
| PubChem CID | 20778076 |
| Molecular Formula | C28H33N3O2Si |
| Molecular Weight | 471.68 g/mol |
| Exact Mass | 471.23 |
| IUPAC Name | (3-aminophenyl)-[3-(2-phenylethyl)-1-(2-trimethylsilylethoxymethyl)indazol-6-yl]methanone |
| SMILES | C[Si](C)(C)CCOCn1nc(CCc2ccccc2)c2ccc(C(=O)c3cccc(N)c3)cc21 |
| InChI | InChI=1S/C28H33N3O2Si/c1-34(2,3)17-16-33-20-31-27-19-23(28(32)22-10-7-11-24(29)18-22)13-14-25(27)26(30-31)15-12-21-8-5-4-6-9-21/h4-11,13-14,18-19H,12,15-17,20,29H2,1-3H3 |
| InChIKey | OYKYBODKOIUJHP-UHFFFAOYSA-N |
| XLogP | 5.95 |
| TPSA | 70.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.68 |
| LogP ≤ 5 | 5.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|