C23H20NO8Y- — CID 20778268
carbanide;[16-(hydroxymethylamino)oxy-10,20-dioxo-9,19-dioxapentacyclo[10.8.0.02,11.03,8.013,18]icosa-3(8),4,6,13(18),14,16-hexaen-6-yl] prop-2-enoate;yttrium (PubChem CID 20778268) has the molecular formula C23H20NO8Y- and a molecular weight of 527.32 g/mol. Its IUPAC name is carbanide;[16-(hydroxymethylamino)oxy-10,20-dioxo-9,19-dioxapentacyclo[10.8.0.02,11.03,8.013,18]icosa-3(8),4,6,13(18),14,16-hexaen-6-yl] prop-2-enoate;yttrium.
| Compound Name | carbanide;[16-(hydroxymethylamino)oxy-10,20-dioxo-9,19-dioxapentacyclo[10.8.0.02,11.03,8.013,18]icosa-3(8),4,6,13(18),14,16-hexaen-6-yl] prop-2-enoate;yttrium |
|---|---|
| PubChem CID | 20778268 |
| Molecular Formula | C23H20NO8Y- |
| Molecular Weight | 527.32 g/mol |
| Exact Mass | 527.03 |
| IUPAC Name | carbanide;[16-(hydroxymethylamino)oxy-10,20-dioxo-9,19-dioxapentacyclo[10.8.0.02,11.03,8.013,18]icosa-3(8),4,6,13(18),14,16-hexaen-6-yl] prop-2-enoate;yttrium |
| SMILES | C=CC(=O)Oc1ccc2c(c1)OC(=O)C1C3c4ccc(ONCO)cc4OC(=O)C3C21.[CH3-].[Y] |
| InChI | InChI=1S/C22H17NO8.CH3.Y/c1-2-16(25)28-10-3-5-12-14(7-10)29-21(26)19-17(12)20-18(19)13-6-4-11(31-23-9-24)8-15(13)30-22(20)27;;/h2-8,17-20,23-24H,1,9H2;1H3;/q;-1; |
| InChIKey | BIEVSOLFTMIQHU-UHFFFAOYSA-N |
| XLogP | 2.01 |
| TPSA | 120.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 527.32 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|