C13H12N4+2 — CID 20784023
2,17-diaza-8,11-diazoniapentacyclo[9.6.0.01,8.02,6.013,17]heptadeca-3,5,7,11,13,15-hexaene (PubChem CID 20784023) has the molecular formula C13H12N4+2 and a molecular weight of 224.27 g/mol. Its IUPAC name is 2,17-diaza-8,11-diazoniapentacyclo[9.6.0.01,8.02,6.013,17]heptadeca-3,5,7,11,13,15-hexaene.
| Compound Name | 2,17-diaza-8,11-diazoniapentacyclo[9.6.0.01,8.02,6.013,17]heptadeca-3,5,7,11,13,15-hexaene |
|---|---|
| PubChem CID | 20784023 |
| Molecular Formula | C13H12N4+2 |
| Molecular Weight | 224.27 g/mol |
| Exact Mass | 224.11 |
| IUPAC Name | 2,17-diaza-8,11-diazoniapentacyclo[9.6.0.01,8.02,6.013,17]heptadeca-3,5,7,11,13,15-hexaene |
| SMILES | C1=[N+]2CC[N+]3=Cc4cccn4C23n2cccc21 |
| InChI | InChI=1S/C13H12N4/c1-3-11-9-14-7-8-15-10-12-4-2-6-17(12)13(14,15)16(11)5-1/h1-6,9-10H,7-8H2/q+2 |
| InChIKey | BZFJXJNXPHUZAP-UHFFFAOYSA-N |
| XLogP | 0.31 |
| TPSA | 15.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.27 |
| LogP ≤ 5 | 0.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|