C10H13N3 — CID 20785148
N,N,6-trimethyl-1H-benzimidazol-5-amine (PubChem CID 20785148) has the molecular formula C10H13N3 and a molecular weight of 175.23 g/mol. Its IUPAC name is N,N,6-trimethyl-1H-benzimidazol-5-amine.
| Compound Name | N,N,6-trimethyl-1H-benzimidazol-5-amine |
|---|---|
| PubChem CID | 20785148 |
| Molecular Formula | C10H13N3 |
| Molecular Weight | 175.23 g/mol |
| Exact Mass | 175.11 |
| IUPAC Name | N,N,6-trimethyl-1H-benzimidazol-5-amine |
| SMILES | Cc1cc2[nH]cnc2cc1N(C)C |
| InChI | InChI=1S/C10H13N3/c1-7-4-8-9(12-6-11-8)5-10(7)13(2)3/h4-6H,1-3H3,(H,11,12) |
| InChIKey | CPHLZWHUZVGKCR-UHFFFAOYSA-N |
| XLogP | 1.94 |
| TPSA | 31.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 175.23 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |