C16H16N2O4S2 — CID 20786533
6-methoxy-3-(2-methoxy-5-methylphenyl)sulfonyl-1H-benzimidazole-2-thione (PubChem CID 20786533) has the molecular formula C16H16N2O4S2 and a molecular weight of 364.45 g/mol. Its IUPAC name is 6-methoxy-3-(2-methoxy-5-methylphenyl)sulfonyl-1H-benzimidazole-2-thione.
| Compound Name | 6-methoxy-3-(2-methoxy-5-methylphenyl)sulfonyl-1H-benzimidazole-2-thione |
|---|---|
| PubChem CID | 20786533 |
| Molecular Formula | C16H16N2O4S2 |
| Molecular Weight | 364.45 g/mol |
| Exact Mass | 364.06 |
| IUPAC Name | 6-methoxy-3-(2-methoxy-5-methylphenyl)sulfonyl-1H-benzimidazole-2-thione |
| SMILES | COc1ccc2c(c1)[nH]c(=S)n2S(=O)(=O)c1cc(C)ccc1OC |
| InChI | InChI=1S/C16H16N2O4S2/c1-10-4-7-14(22-3)15(8-10)24(19,20)18-13-6-5-11(21-2)9-12(13)17-16(18)23/h4-9H,1-3H3,(H,17,23) |
| InChIKey | YHCMROWIBACMRF-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 73.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.45 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|