C10H6Cl2N2OS — CID 20787767
(5Z)-4-amino-5-[(2,6-dichlorophenyl)methylidene]-1,3-thiazol-2-one (PubChem CID 20787767) has the molecular formula C10H6Cl2N2OS and a molecular weight of 273.14 g/mol. Its IUPAC name is (5Z)-4-amino-5-[(2,6-dichlorophenyl)methylidene]-1,3-thiazol-2-one.
| Compound Name | (5Z)-4-amino-5-[(2,6-dichlorophenyl)methylidene]-1,3-thiazol-2-one |
|---|---|
| PubChem CID | 20787767 |
| Molecular Formula | C10H6Cl2N2OS |
| Molecular Weight | 273.14 g/mol |
| Exact Mass | 271.96 |
| IUPAC Name | (5Z)-4-amino-5-[(2,6-dichlorophenyl)methylidene]-1,3-thiazol-2-one |
| SMILES | NC1=NC(=O)S/C1=C\c1c(Cl)cccc1Cl |
| InChI | InChI=1S/C10H6Cl2N2OS/c11-6-2-1-3-7(12)5(6)4-8-9(13)14-10(15)16-8/h1-4H,(H2,13,14,15)/b8-4- |
| InChIKey | KMNGIJCCRAGJHH-YWEYNIOJSA-N |
| XLogP | 3.56 |
| TPSA | 55.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.14 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|