C10H7ClN2OS — CID 4737174
4-amino-5-[(4-chlorophenyl)methylidene]-1,3-thiazol-2-one (PubChem CID 4737174) has the molecular formula C10H7ClN2OS and a molecular weight of 238.70 g/mol. Its IUPAC name is 4-amino-5-[(4-chlorophenyl)methylidene]-1,3-thiazol-2-one.
| Compound Name | 4-amino-5-[(4-chlorophenyl)methylidene]-1,3-thiazol-2-one |
|---|---|
| PubChem CID | 4737174 |
| Molecular Formula | C10H7ClN2OS |
| Molecular Weight | 238.70 g/mol |
| Exact Mass | 238.00 |
| IUPAC Name | 4-amino-5-[(4-chlorophenyl)methylidene]-1,3-thiazol-2-one |
| SMILES | NC1=NC(=O)SC1=Cc1ccc(Cl)cc1 |
| InChI | InChI=1S/C10H7ClN2OS/c11-7-3-1-6(2-4-7)5-8-9(12)13-10(14)15-8/h1-5H,(H2,12,13,14) |
| InChIKey | PAQCNGASJGYLHA-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 55.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.70 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|