C16H10ClNOS — CID 712140
4-[(4-chlorophenyl)methylidene]-2-phenyl-1,3-thiazol-5-one (PubChem CID 712140) has the molecular formula C16H10ClNOS and a molecular weight of 299.78 g/mol. Its IUPAC name is 4-[(4-chlorophenyl)methylidene]-2-phenyl-1,3-thiazol-5-one.
| Compound Name | 4-[(4-chlorophenyl)methylidene]-2-phenyl-1,3-thiazol-5-one |
|---|---|
| PubChem CID | 712140 |
| Molecular Formula | C16H10ClNOS |
| Molecular Weight | 299.78 g/mol |
| Exact Mass | 299.02 |
| IUPAC Name | 4-[(4-chlorophenyl)methylidene]-2-phenyl-1,3-thiazol-5-one |
| SMILES | O=C1SC(c2ccccc2)=NC1=Cc1ccc(Cl)cc1 |
| InChI | InChI=1S/C16H10ClNOS/c17-13-8-6-11(7-9-13)10-14-16(19)20-15(18-14)12-4-2-1-3-5-12/h1-10H |
| InChIKey | CBKTYDYUGNEVDL-UHFFFAOYSA-N |
| XLogP | 4.40 |
| TPSA | 29.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.78 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'ene_five_het_G(10)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|