C29H24N4O2 — CID 20791003
3-benzyl-1-(5-methyl-4-oxo-1-phenyl-1,8-naphthyridin-2-yl)-1-phenylurea (PubChem CID 20791003) has the molecular formula C29H24N4O2 and a molecular weight of 460.54 g/mol. Its IUPAC name is 3-benzyl-1-(5-methyl-4-oxo-1-phenyl-1,8-naphthyridin-2-yl)-1-phenylurea.
| Compound Name | 3-benzyl-1-(5-methyl-4-oxo-1-phenyl-1,8-naphthyridin-2-yl)-1-phenylurea |
|---|---|
| PubChem CID | 20791003 |
| Molecular Formula | C29H24N4O2 |
| Molecular Weight | 460.54 g/mol |
| Exact Mass | 460.19 |
| IUPAC Name | 3-benzyl-1-(5-methyl-4-oxo-1-phenyl-1,8-naphthyridin-2-yl)-1-phenylurea |
| SMILES | Cc1ccnc2c1c(=O)cc(N(C(=O)NCc1ccccc1)c1ccccc1)n2-c1ccccc1 |
| InChI | InChI=1S/C29H24N4O2/c1-21-17-18-30-28-27(21)25(34)19-26(32(28)23-13-7-3-8-14-23)33(24-15-9-4-10-16-24)29(35)31-20-22-11-5-2-6-12-22/h2-19H,20H2,1H3,(H,31,35) |
| InChIKey | WKIXZEVSFDISIS-UHFFFAOYSA-N |
| XLogP | 5.74 |
| TPSA | 67.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.54 |
| LogP ≤ 5 | 5.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |