C26H25ClN4O4S — CID 20799235
1-(N-tert-butyl-S-phenylsulfonimidoyl)-3-[4-(5-chloro-1,3-dioxoisoindol-2-yl)-3-methylphenyl]urea (PubChem CID 20799235) has the molecular formula C26H25ClN4O4S and a molecular weight of 525.03 g/mol. Its IUPAC name is 1-(N-tert-butyl-S-phenylsulfonimidoyl)-3-[4-(5-chloro-1,3-dioxoisoindol-2-yl)-3-methylphenyl]urea.
| Compound Name | 1-(N-tert-butyl-S-phenylsulfonimidoyl)-3-[4-(5-chloro-1,3-dioxoisoindol-2-yl)-3-methylphenyl]urea |
|---|---|
| PubChem CID | 20799235 |
| Molecular Formula | C26H25ClN4O4S |
| Molecular Weight | 525.03 g/mol |
| Exact Mass | 524.13 |
| IUPAC Name | 1-(N-tert-butyl-S-phenylsulfonimidoyl)-3-[4-(5-chloro-1,3-dioxoisoindol-2-yl)-3-methylphenyl]urea |
| SMILES | Cc1cc(NC(=O)NS(=O)(=NC(C)(C)C)c2ccccc2)ccc1N1C(=O)c2ccc(Cl)cc2C1=O |
| InChI | InChI=1S/C26H25ClN4O4S/c1-16-14-18(11-13-22(16)31-23(32)20-12-10-17(27)15-21(20)24(31)33)28-25(34)29-36(35,30-26(2,3)4)19-8-6-5-7-9-19/h5-15H,1-4H3,(H2,28,29,30,34,35) |
| InChIKey | FTIBPBQJQJMVQA-UHFFFAOYSA-N |
| XLogP | 5.81 |
| TPSA | 107.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 525.03 |
| LogP ≤ 5 | 5.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|